Pigment yellow 65 – Corimax Yellow RN
Parameter teknis pigmen kuning 65
| Indeks Warna No. | Pigmen kuning 65 |
| Jeneng produk | Rima Kuning RN |
| Kategori produk | Pigmen Organik |
| Nomer CAS | 6528-34-3 |
| Nomer EU | 229-419-9 |
| Kulawarga Kimia | Monazo |
| Bobot molekuler | 386.36 |
| Formula Molekuler | C18H18N4O6 |
| Nilai PH | 6.0-7.0 |
| Kapadhetan | 1.6 |
| Penyerapan Minyak (ml / 100g)% | 35-45 |
| Cepet Cepet (lapisan) | 7 |
| Ketahanan Kalor (lapisan) | 140 |
| Resistensi banyu | 5 |
| Resistensi Minyak | 3 |
| Resep Asam | 5 |
| Nyegah Alkali | 5 |
Werna | ![]() |
| Distribusi Hue |
Fitur: Semalat sing apik.
Aplikasi:
Disaranake kanggo lapisan arsitektur, lapisan industri.
Informasi sing gegandhengan
Pigment Yellow 65 is a high-performance, bright yellow pigment widely used in coatings, inks, plastics, and paints. It offers excellent lightfastness, weather resistance, and chemical stability, making it suitable for both indoor and outdoor applications. Known for its vibrant, clean yellow hue, it provides strong color strength and opacity, ensuring high-quality results. Pigment Yellow 65 is particularly popular in automotive coatings, printing inks, and industrial applications where durability and consistency are crucial. With its non-toxic and environmentally friendly properties, it is a reliable choice for manufacturers seeking long-lasting and vivid yellow colors.
Struktur molekuler:
Formula Molekular: C18H18N4O6
Bobot molekular: 386.36
Nomer Registrasi CAS: 6528-34-3
Metode Manufaktur: 4-Methoxy-2-nitrobenzenamine diazotization, lan N- (2-methoxyphenyl) -3-oxobutanamide kopling.
Properti lan Aplikasi: lampu abang sing cerah kuning. Wêdakakêna abrit. Cepet srengenge luwih cepet. Rintangan kanggo Cellosole, minyak tanah, ora bisa metokake utawa tahan xylene, alkali-asam luwih apik. Ing medium berminyak, utamane ing lapisan lateks sing digunakake, uga bisa digunakake kanggo pewarnaan lapisan, karet, budaya lan pendhidhikan.
Structural Identifiers
IUPAC Name: 2-[(4-Methoxy-2-nitrophenyl)diazenyl]-N-(2-methoxyphenyl)-3-oxobutanamide
SMILES: COC1=CC(=C(C=C1)N=NC(C(C)=O)C(=O)NC1=C(OC)C=CC=C1)[N+]([O-])=O
InChI String: InChI=1/C18H18N4O6/c1-11(23)17(18(24)19-14-6-4-5-7-16(14)28-3)21-20-13-9-8-12(27-2)10-15(13)22(25)26/h4-10,17H,1-3H3,(H,19,24)
InChIKey: UFORAEIAYCSGCR-UHFFFAOYSA-N
sinonim
| 6528-34-3 |
| Permanent Yellow Rn |
| YELLOW65 |
| 2-[(4-methoxy-2-nitrophenyl)diazenyl]-N-(2-methoxyphenyl)-3-oxobutanamide |
| Butanamide,2-[(4-methoxy-2-nitrophenyl)azo]-N-(2-methoxyphenyl)-3-oxo- |
| Butanamide, 2-((4-methoxy-2-nitrophenyl)azo)-N-(2-methoxyphenyl)-3-oxo- |
| Butanamide, 2-[(4-methoxy-2-nitrophenyl)azo]-N-(2-methoxyphenyl)-3-oxo- |
| 2-[2-(4-METHOXY-2-NITROPHENYL)DIAZEN-1-YL]-N-(2-METHOXYPHENYL)-3-OXOBUTANAMIDE |
| EINECS 229-419-9 |
| EC 229-419-9 |
| SCHEMBL6928762 |
| 2-((4-Methoxy-2-nitrophenyl)azo)-o-acetoacetanisidide |
| DTXSID0052336 |
| SCHEMBL12760851 |
| UFORAEIAYCSGCR-UHFFFAOYSA-N |
| HY-D1204 |
| MFCD00071941 |
| AKOS037643608 |
| Butanamide, 2-(2-(4-methoxy-2-nitrophenyl)diazenyl)-N-(2-methoxyphenyl)-3-oxo- |
| AS-17500 |
| CS-0143082 |
| NS00003477 |
| EN300-207584 |
| 2-((4-Methoxy-2-nitrophenyl)azo)-N-(2-methoxyphenyl)-3-oxobutyramide |
| (E)-2-((4-methoxy-2-nitrophenyl)diazenyl)-N-(2-methoxyphenyl)-3-oxobutanamide |
Computed Properties
| Property Name | Property Value |
| Bobot molekuler | 386.4 g/mol |
| XLogP3-AA | 3.3 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 8 |
| Rotatable Bond Count | 7 |
| Exact Mass | 386.12263431 Da |
| Monoisotopic Mass | 386.12263431 Da |
| Topological Polar Surface Area | 135 Ų |
| Heavy Atom Count | 28 |
| Formal Charge | 0 |
| Complexity | 593 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 1 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| Covalently-Bonded Unit Count | 1 |
| Compound Is Canonicalized | Yes |











